C18H19NO3S — CID 89037533
5'-[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfanylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one (PubChem CID 89037533) has the molecular formula C18H19NO3S and a molecular weight of 329.42 g/mol. Its IUPAC name is 5'-[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfanylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one.
| Compound Name | 5'-[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfanylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one |
|---|---|
| PubChem CID | 89037533 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 5'-[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfanylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one |
| SMILES | C=C/C=C\C(=C/C)Sc1ccc2c(c1)C1(OCCCO1)C(=O)N2 |
| InChI | InChI=1S/C18H19NO3S/c1-3-5-7-13(4-2)23-14-8-9-16-15(12-14)18(17(20)19-16)21-10-6-11-22-18/h3-5,7-9,12H,1,6,10-11H2,2H3,(H,19,20)/b7-5-,13-4+ |
| InChIKey | PTUODRBJUPUGIB-KYKRJZGISA-N |
| XLogP | 3.97 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|