C14H23N3 — CID 89037599
1-N-prop-1-en-2-yl-1-N-(2,3,4,5-tetrahydropyridin-5-yl)cyclohex-3-ene-1,2-diamine (PubChem CID 89037599) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 1-N-prop-1-en-2-yl-1-N-(2,3,4,5-tetrahydropyridin-5-yl)cyclohex-3-ene-1,2-diamine.
| Compound Name | 1-N-prop-1-en-2-yl-1-N-(2,3,4,5-tetrahydropyridin-5-yl)cyclohex-3-ene-1,2-diamine |
|---|---|
| PubChem CID | 89037599 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 1-N-prop-1-en-2-yl-1-N-(2,3,4,5-tetrahydropyridin-5-yl)cyclohex-3-ene-1,2-diamine |
| SMILES | C=C(C)N(C1C=NCCC1)C1CCC=CC1N |
| InChI | InChI=1S/C14H23N3/c1-11(2)17(12-6-5-9-16-10-12)14-8-4-3-7-13(14)15/h3,7,10,12-14H,1,4-6,8-9,15H2,2H3 |
| InChIKey | YFKIYGIIEHPGFN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|