C16H16ClN3O4 — CID 89037715
trans-(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl (1R,3R)-3-[(Z)-2-chloro-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 89037715) has the molecular formula C16H16ClN3O4 and a molecular weight of 349.77 g/mol. Its IUPAC name is trans-(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl (1R,3R)-3-[(Z)-2-chloro-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl (1R,3R)-3-[(Z)-2-chloro-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 89037715 |
| Molecular Formula | C16H16ClN3O4 |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | trans-(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl (1R,3R)-3-[(Z)-2-chloro-2-cyanoethenyl]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | C#CCN1CC(=O)N(COC(=O)[C@@H]2[C@H](/C=C(\Cl)C#N)C2(C)C)C1=O |
| InChI | InChI=1S/C16H16ClN3O4/c1-4-5-19-8-12(21)20(15(19)23)9-24-14(22)13-11(16(13,2)3)6-10(17)7-18/h1,6,11,13H,5,8-9H2,2-3H3/b10-6-/t11-,13-/m0/s1 |
| InChIKey | NQMBJIYVASJODB-GVCSVAHDSA-N |
| XLogP | 1.30 |
| TPSA | 90.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|