C24H25ClN6O — CID 89037721
6-[[4-(4-chlorophenyl)-1-[(2E)-2-[(Z)-hydrazinylidenemethyl]-4-methylpenta-2,4-dienoyl]pyrrolidin-3-yl]methylamino]pyridine-3-carbonitrile (PubChem CID 89037721) has the molecular formula C24H25ClN6O and a molecular weight of 448.96 g/mol. Its IUPAC name is 6-[[4-(4-chlorophenyl)-1-[(2E)-2-[(Z)-hydrazinylidenemethyl]-4-methylpenta-2,4-dienoyl]pyrrolidin-3-yl]methylamino]pyridine-3-carbonitrile.
| Compound Name | 6-[[4-(4-chlorophenyl)-1-[(2E)-2-[(Z)-hydrazinylidenemethyl]-4-methylpenta-2,4-dienoyl]pyrrolidin-3-yl]methylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 89037721 |
| Molecular Formula | C24H25ClN6O |
| Molecular Weight | 448.96 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 6-[[4-(4-chlorophenyl)-1-[(2E)-2-[(Z)-hydrazinylidenemethyl]-4-methylpenta-2,4-dienoyl]pyrrolidin-3-yl]methylamino]pyridine-3-carbonitrile |
| SMILES | C=C(C)/C=C(\C=N/N)C(=O)N1CC(CNc2ccc(C#N)cn2)C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C24H25ClN6O/c1-16(2)9-19(13-30-27)24(32)31-14-20(12-29-23-8-3-17(10-26)11-28-23)22(15-31)18-4-6-21(25)7-5-18/h3-9,11,13,20,22H,1,12,14-15,27H2,2H3,(H,28,29)/b19-9+,30-13- |
| InChIKey | CWUGNWTUBXLVRZ-CVGUMOPSSA-N |
| XLogP | 3.71 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.96 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|