C21H37NO6 — CID 89037946
6-[(1-carboxy-5,5-dimethyl-4-oxohexyl)amino]-2,2,4,4,6-pentamethyl-5-oxoheptanoic acid (PubChem CID 89037946) has the molecular formula C21H37NO6 and a molecular weight of 399.53 g/mol. Its IUPAC name is 6-[(1-carboxy-5,5-dimethyl-4-oxohexyl)amino]-2,2,4,4,6-pentamethyl-5-oxoheptanoic acid.
| Compound Name | 6-[(1-carboxy-5,5-dimethyl-4-oxohexyl)amino]-2,2,4,4,6-pentamethyl-5-oxoheptanoic acid |
|---|---|
| PubChem CID | 89037946 |
| Molecular Formula | C21H37NO6 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | 6-[(1-carboxy-5,5-dimethyl-4-oxohexyl)amino]-2,2,4,4,6-pentamethyl-5-oxoheptanoic acid |
| SMILES | CC(C)(C)C(=O)CCC(NC(C)(C)C(=O)C(C)(C)CC(C)(C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C21H37NO6/c1-18(2,3)14(23)11-10-13(15(24)25)22-21(8,9)16(26)19(4,5)12-20(6,7)17(27)28/h13,22H,10-12H2,1-9H3,(H,24,25)(H,27,28) |
| InChIKey | ZAKLONHSWKTZAY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |