C15H23N — CID 89038332
(2Z,5Z,9Z)-2,6,10-trimethylcyclododeca-2,5,9-trien-1-imine (PubChem CID 89038332) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is (2Z,5Z,9Z)-2,6,10-trimethylcyclododeca-2,5,9-trien-1-imine.
| Compound Name | (2Z,5Z,9Z)-2,6,10-trimethylcyclododeca-2,5,9-trien-1-imine |
|---|---|
| PubChem CID | 89038332 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (2Z,5Z,9Z)-2,6,10-trimethylcyclododeca-2,5,9-trien-1-imine |
| SMILES | [H]/N=C1CC/C(C)=C\CC/C(C)=C\C/C=C\1C |
| InChI | InChI=1S/C15H23N/c1-12-6-4-7-13(2)10-11-15(16)14(3)9-5-8-12/h7-9,16H,4-6,10-11H2,1-3H3/b12-8-,13-7-,14-9-,16-15+ |
| InChIKey | LJYUCXWYEXXFSD-BARLQJHKSA-N |
| XLogP | 4.81 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|