C7H14O3 — CID 89038493
(3R,4R)-2,4-dimethyloxane-3,4-diol (PubChem CID 89038493) has the molecular formula C7H14O3 and a molecular weight of 146.19 g/mol. Its IUPAC name is (3R,4R)-2,4-dimethyloxane-3,4-diol.
| Compound Name | (3R,4R)-2,4-dimethyloxane-3,4-diol |
|---|---|
| PubChem CID | 89038493 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | (3R,4R)-2,4-dimethyloxane-3,4-diol |
| SMILES | CC1OCC[C@@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C7H14O3/c1-5-6(8)7(2,9)3-4-10-5/h5-6,8-9H,3-4H2,1-2H3/t5?,6-,7-/m1/s1 |
| InChIKey | OCJPGCRTKIKNFB-JXBXZBNISA-N |
| XLogP | -0.09 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |