About N-iodo-3-[(E)-prop-1-enyl]-2,3-dihydropyridin-6-amine
N-iodo-3-[(E)-prop-1-enyl]-2,3-dihydropyridin-6-amine (PubChem CID 89038546) has the molecular formula C8H11IN2
and a molecular weight of 262.09 g/mol. Its IUPAC name is N-iodo-3-[(E)-prop-1-enyl]-2,3-dihydropyridin-6-amine.
Molecular Properties
| Compound Name | N-iodo-3-[(E)-prop-1-enyl]-2,3-dihydropyridin-6-amine |
| PubChem CID | 89038546 |
| Molecular Formula | C8H11IN2 |
| Molecular Weight | 262.09 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | N-iodo-3-[(E)-prop-1-enyl]-2,3-dihydropyridin-6-amine |
| SMILES | C/C=C/C1C=CC(NI)=NC1 |
| InChI | InChI=1S/C8H11IN2/c1-2-3-7-4-5-8(11-9)10-6-7/h2-5,7H,6H2,1H3,(H,10,11)/b3-2+ |
| InChIKey | YHKAEUKHZNVATQ-NSCUHMNNSA-N |
| XLogP | 2.09 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.09 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-iodo-3-[(E)-prop-1-enyl]-2,3-dihydropyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-iodo-3-[(E)-prop-1-enyl]-2,3-dihydropyridin-6-amine?
The IUPAC name of N-iodo-3-[(E)-prop-1-enyl]-2,3-dihydropyridin-6-amine (CID 89038546) is N-iodo-3-[(E)-prop-1-enyl]-2,3-dihydropyridin-6-amine.
What is the SMILES notation for N-iodo-3-[(E)-prop-1-enyl]-2,3-dihydropyridin-6-amine?
The canonical SMILES for N-iodo-3-[(E)-prop-1-enyl]-2,3-dihydropyridin-6-amine is C/C=C/C1C=CC(NI)=NC1.
What is the InChIKey of N-iodo-3-[(E)-prop-1-enyl]-2,3-dihydropyridin-6-amine?
The InChIKey is YHKAEUKHZNVATQ-NSCUHMNNSA-N. The full InChI is InChI=1S/C8H11IN2/c1-2-3-7-4-5-8(11-9)10-6-7/h2-5,7H,6H2,1H3,(H,10,11)/b3-2+.
What are the key properties of N-iodo-3-[(E)-prop-1-enyl]-2,3-dihydropyridin-6-amine?
N-iodo-3-[(E)-prop-1-enyl]-2,3-dihydropyridin-6-amine has a molecular weight of 262.09 g/mol, XLogP of 2.09, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-iodo-3-[(E)-prop-1-enyl]-2,3-dihydropyridin-6-amine is sourced from PubChem (CID 89038546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).