About (3E)-3-(1-methyl-4,5-dihydrobenzimidazol-2-yl)hexa-3,5-dien-1-amine
(3E)-3-(1-methyl-4,5-dihydrobenzimidazol-2-yl)hexa-3,5-dien-1-amine (PubChem CID 89038734) has the molecular formula C14H19N3
and a molecular weight of 229.33 g/mol. Its IUPAC name is (3E)-3-(1-methyl-4,5-dihydrobenzimidazol-2-yl)hexa-3,5-dien-1-amine.
Molecular Properties
| Compound Name | (3E)-3-(1-methyl-4,5-dihydrobenzimidazol-2-yl)hexa-3,5-dien-1-amine |
| PubChem CID | 89038734 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | (3E)-3-(1-methyl-4,5-dihydrobenzimidazol-2-yl)hexa-3,5-dien-1-amine |
| SMILES | C=C/C=C(\CCN)c1nc2c(n1C)C=CCC2 |
| InChI | InChI=1S/C14H19N3/c1-3-6-11(9-10-15)14-16-12-7-4-5-8-13(12)17(14)2/h3,5-6,8H,1,4,7,9-10,15H2,2H3/b11-6+ |
| InChIKey | ZQQPEMMCZJHVAT-IZZDOVSWSA-N |
| XLogP | 2.30 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-(1-methyl-4,5-dihydrobenzimidazol-2-yl)hexa-3,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-(1-methyl-4,5-dihydrobenzimidazol-2-yl)hexa-3,5-dien-1-amine?
The IUPAC name of (3E)-3-(1-methyl-4,5-dihydrobenzimidazol-2-yl)hexa-3,5-dien-1-amine (CID 89038734) is (3E)-3-(1-methyl-4,5-dihydrobenzimidazol-2-yl)hexa-3,5-dien-1-amine.
What is the SMILES notation for (3E)-3-(1-methyl-4,5-dihydrobenzimidazol-2-yl)hexa-3,5-dien-1-amine?
The canonical SMILES for (3E)-3-(1-methyl-4,5-dihydrobenzimidazol-2-yl)hexa-3,5-dien-1-amine is C=C/C=C(\CCN)c1nc2c(n1C)C=CCC2.
What is the InChIKey of (3E)-3-(1-methyl-4,5-dihydrobenzimidazol-2-yl)hexa-3,5-dien-1-amine?
The InChIKey is ZQQPEMMCZJHVAT-IZZDOVSWSA-N. The full InChI is InChI=1S/C14H19N3/c1-3-6-11(9-10-15)14-16-12-7-4-5-8-13(12)17(14)2/h3,5-6,8H,1,4,7,9-10,15H2,2H3/b11-6+.
What are the key properties of (3E)-3-(1-methyl-4,5-dihydrobenzimidazol-2-yl)hexa-3,5-dien-1-amine?
(3E)-3-(1-methyl-4,5-dihydrobenzimidazol-2-yl)hexa-3,5-dien-1-amine has a molecular weight of 229.33 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-(1-methyl-4,5-dihydrobenzimidazol-2-yl)hexa-3,5-dien-1-amine is sourced from PubChem (CID 89038734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).