About 2,3,5,6-tetrahydro-1H-indole
2,3,5,6-tetrahydro-1H-indole (PubChem CID 89038750) has the molecular formula C8H11N
and a molecular weight of 121.18 g/mol. Its IUPAC name is 2,3,5,6-tetrahydro-1H-indole.
Molecular Properties
| Compound Name | 2,3,5,6-tetrahydro-1H-indole |
| PubChem CID | 89038750 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 2,3,5,6-tetrahydro-1H-indole |
| SMILES | C1=C2CCNC2=CCC1 |
| InChI | InChI=1S/C8H11N/c1-2-4-8-7(3-1)5-6-9-8/h3-4,9H,1-2,5-6H2 |
| InChIKey | FHCUHYMAFOBZFT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3,5,6-tetrahydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5,6-tetrahydro-1H-indole?
The IUPAC name of 2,3,5,6-tetrahydro-1H-indole (CID 89038750) is 2,3,5,6-tetrahydro-1H-indole.
What is the SMILES notation for 2,3,5,6-tetrahydro-1H-indole?
The canonical SMILES for 2,3,5,6-tetrahydro-1H-indole is C1=C2CCNC2=CCC1.
What is the InChIKey of 2,3,5,6-tetrahydro-1H-indole?
The InChIKey is FHCUHYMAFOBZFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N/c1-2-4-8-7(3-1)5-6-9-8/h3-4,9H,1-2,5-6H2.
What are the key properties of 2,3,5,6-tetrahydro-1H-indole?
2,3,5,6-tetrahydro-1H-indole has a molecular weight of 121.18 g/mol, XLogP of 1.58, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5,6-tetrahydro-1H-indole is sourced from PubChem (CID 89038750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).