About (5Z)-5-methyl-7-(methylamino)nona-5,8-dien-4-ol
(5Z)-5-methyl-7-(methylamino)nona-5,8-dien-4-ol (PubChem CID 89038763) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is (5Z)-5-methyl-7-(methylamino)nona-5,8-dien-4-ol.
Molecular Properties
| Compound Name | (5Z)-5-methyl-7-(methylamino)nona-5,8-dien-4-ol |
| PubChem CID | 89038763 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (5Z)-5-methyl-7-(methylamino)nona-5,8-dien-4-ol |
| SMILES | C=CC(/C=C(/C)C(O)CCC)NC |
| InChI | InChI=1S/C11H21NO/c1-5-7-11(13)9(3)8-10(6-2)12-4/h6,8,10-13H,2,5,7H2,1,3-4H3/b9-8- |
| InChIKey | WYYXXJWYJGWHLN-HJWRWDBZSA-N |
| XLogP | 1.87 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-5-methyl-7-(methylamino)nona-5,8-dien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-methyl-7-(methylamino)nona-5,8-dien-4-ol?
The IUPAC name of (5Z)-5-methyl-7-(methylamino)nona-5,8-dien-4-ol (CID 89038763) is (5Z)-5-methyl-7-(methylamino)nona-5,8-dien-4-ol.
What is the SMILES notation for (5Z)-5-methyl-7-(methylamino)nona-5,8-dien-4-ol?
The canonical SMILES for (5Z)-5-methyl-7-(methylamino)nona-5,8-dien-4-ol is C=CC(/C=C(/C)C(O)CCC)NC.
What is the InChIKey of (5Z)-5-methyl-7-(methylamino)nona-5,8-dien-4-ol?
The InChIKey is WYYXXJWYJGWHLN-HJWRWDBZSA-N. The full InChI is InChI=1S/C11H21NO/c1-5-7-11(13)9(3)8-10(6-2)12-4/h6,8,10-13H,2,5,7H2,1,3-4H3/b9-8-.
What are the key properties of (5Z)-5-methyl-7-(methylamino)nona-5,8-dien-4-ol?
(5Z)-5-methyl-7-(methylamino)nona-5,8-dien-4-ol has a molecular weight of 183.29 g/mol, XLogP of 1.87, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-methyl-7-(methylamino)nona-5,8-dien-4-ol is sourced from PubChem (CID 89038763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).