About 2-N-ethyl-2-N-prop-1-en-2-ylcyclohexa-1,3-diene-1,2-diamine
2-N-ethyl-2-N-prop-1-en-2-ylcyclohexa-1,3-diene-1,2-diamine (PubChem CID 89038774) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 2-N-ethyl-2-N-prop-1-en-2-ylcyclohexa-1,3-diene-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-ethyl-2-N-prop-1-en-2-ylcyclohexa-1,3-diene-1,2-diamine |
| PubChem CID | 89038774 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 2-N-ethyl-2-N-prop-1-en-2-ylcyclohexa-1,3-diene-1,2-diamine |
| SMILES | C=C(C)N(CC)C1=C(N)CCC=C1 |
| InChI | InChI=1S/C11H18N2/c1-4-13(9(2)3)11-8-6-5-7-10(11)12/h6,8H,2,4-5,7,12H2,1,3H3 |
| InChIKey | PRLOKKWCOXZPQR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-N-ethyl-2-N-prop-1-en-2-ylcyclohexa-1,3-diene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-ethyl-2-N-prop-1-en-2-ylcyclohexa-1,3-diene-1,2-diamine?
The IUPAC name of 2-N-ethyl-2-N-prop-1-en-2-ylcyclohexa-1,3-diene-1,2-diamine (CID 89038774) is 2-N-ethyl-2-N-prop-1-en-2-ylcyclohexa-1,3-diene-1,2-diamine.
What is the SMILES notation for 2-N-ethyl-2-N-prop-1-en-2-ylcyclohexa-1,3-diene-1,2-diamine?
The canonical SMILES for 2-N-ethyl-2-N-prop-1-en-2-ylcyclohexa-1,3-diene-1,2-diamine is C=C(C)N(CC)C1=C(N)CCC=C1.
What is the InChIKey of 2-N-ethyl-2-N-prop-1-en-2-ylcyclohexa-1,3-diene-1,2-diamine?
The InChIKey is PRLOKKWCOXZPQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2/c1-4-13(9(2)3)11-8-6-5-7-10(11)12/h6,8H,2,4-5,7,12H2,1,3H3.
What are the key properties of 2-N-ethyl-2-N-prop-1-en-2-ylcyclohexa-1,3-diene-1,2-diamine?
2-N-ethyl-2-N-prop-1-en-2-ylcyclohexa-1,3-diene-1,2-diamine has a molecular weight of 178.28 g/mol, XLogP of 2.36, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-ethyl-2-N-prop-1-en-2-ylcyclohexa-1,3-diene-1,2-diamine is sourced from PubChem (CID 89038774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).