About (2E)-4,11-dimethyl-5-(sulfanylmethyl)tetradeca-2,13-dien-6-ol
(2E)-4,11-dimethyl-5-(sulfanylmethyl)tetradeca-2,13-dien-6-ol (PubChem CID 89038833) has the molecular formula C17H32OS
and a molecular weight of 284.51 g/mol. Its IUPAC name is (2E)-4,11-dimethyl-5-(sulfanylmethyl)tetradeca-2,13-dien-6-ol.
Molecular Properties
| Compound Name | (2E)-4,11-dimethyl-5-(sulfanylmethyl)tetradeca-2,13-dien-6-ol |
| PubChem CID | 89038833 |
| Molecular Formula | C17H32OS |
| Molecular Weight | 284.51 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | (2E)-4,11-dimethyl-5-(sulfanylmethyl)tetradeca-2,13-dien-6-ol |
| SMILES | C=CCC(C)CCCCC(O)C(CS)C(C)/C=C/C |
| InChI | InChI=1S/C17H32OS/c1-5-9-14(3)11-7-8-12-17(18)16(13-19)15(4)10-6-2/h5-6,10,14-19H,1,7-9,11-13H2,2-4H3/b10-6+ |
| InChIKey | XESXSEYAHNFAFK-UXBLZVDNSA-N |
| XLogP | 4.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2E)-4,11-dimethyl-5-(sulfanylmethyl)tetradeca-2,13-dien-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-4,11-dimethyl-5-(sulfanylmethyl)tetradeca-2,13-dien-6-ol?
The IUPAC name of (2E)-4,11-dimethyl-5-(sulfanylmethyl)tetradeca-2,13-dien-6-ol (CID 89038833) is (2E)-4,11-dimethyl-5-(sulfanylmethyl)tetradeca-2,13-dien-6-ol.
What is the SMILES notation for (2E)-4,11-dimethyl-5-(sulfanylmethyl)tetradeca-2,13-dien-6-ol?
The canonical SMILES for (2E)-4,11-dimethyl-5-(sulfanylmethyl)tetradeca-2,13-dien-6-ol is C=CCC(C)CCCCC(O)C(CS)C(C)/C=C/C.
What is the InChIKey of (2E)-4,11-dimethyl-5-(sulfanylmethyl)tetradeca-2,13-dien-6-ol?
The InChIKey is XESXSEYAHNFAFK-UXBLZVDNSA-N. The full InChI is InChI=1S/C17H32OS/c1-5-9-14(3)11-7-8-12-17(18)16(13-19)15(4)10-6-2/h5-6,10,14-19H,1,7-9,11-13H2,2-4H3/b10-6+.
What are the key properties of (2E)-4,11-dimethyl-5-(sulfanylmethyl)tetradeca-2,13-dien-6-ol?
(2E)-4,11-dimethyl-5-(sulfanylmethyl)tetradeca-2,13-dien-6-ol has a molecular weight of 284.51 g/mol, XLogP of 4.88, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-4,11-dimethyl-5-(sulfanylmethyl)tetradeca-2,13-dien-6-ol is sourced from PubChem (CID 89038833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).