About 5-bromo-1-methyl-[1,2]oxazolo[3,4-b]pyrazin-3-one
5-bromo-1-methyl-[1,2]oxazolo[3,4-b]pyrazin-3-one (PubChem CID 89038899) has the molecular formula C6H4BrN3O2
and a molecular weight of 230.02 g/mol. Its IUPAC name is 5-bromo-1-methyl-[1,2]oxazolo[3,4-b]pyrazin-3-one.
Molecular Properties
| Compound Name | 5-bromo-1-methyl-[1,2]oxazolo[3,4-b]pyrazin-3-one |
| PubChem CID | 89038899 |
| Molecular Formula | C6H4BrN3O2 |
| Molecular Weight | 230.02 g/mol |
| Exact Mass | 228.95 |
| IUPAC Name | 5-bromo-1-methyl-[1,2]oxazolo[3,4-b]pyrazin-3-one |
| SMILES | Cn1oc(=O)c2nc(Br)cnc21 |
| InChI | InChI=1S/C6H4BrN3O2/c1-10-5-4(6(11)12-10)9-3(7)2-8-5/h2H,1H3 |
| InChIKey | QWYUTWONKXPMOC-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.02 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-1-methyl-[1,2]oxazolo[3,4-b]pyrazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-methyl-[1,2]oxazolo[3,4-b]pyrazin-3-one?
The IUPAC name of 5-bromo-1-methyl-[1,2]oxazolo[3,4-b]pyrazin-3-one (CID 89038899) is 5-bromo-1-methyl-[1,2]oxazolo[3,4-b]pyrazin-3-one.
What is the SMILES notation for 5-bromo-1-methyl-[1,2]oxazolo[3,4-b]pyrazin-3-one?
The canonical SMILES for 5-bromo-1-methyl-[1,2]oxazolo[3,4-b]pyrazin-3-one is Cn1oc(=O)c2nc(Br)cnc21.
What is the InChIKey of 5-bromo-1-methyl-[1,2]oxazolo[3,4-b]pyrazin-3-one?
The InChIKey is QWYUTWONKXPMOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrN3O2/c1-10-5-4(6(11)12-10)9-3(7)2-8-5/h2H,1H3.
What are the key properties of 5-bromo-1-methyl-[1,2]oxazolo[3,4-b]pyrazin-3-one?
5-bromo-1-methyl-[1,2]oxazolo[3,4-b]pyrazin-3-one has a molecular weight of 230.02 g/mol, XLogP of 0.68, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-methyl-[1,2]oxazolo[3,4-b]pyrazin-3-one is sourced from PubChem (CID 89038899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).