C19H38N2O — CID 89038965
1-N-[(E,4R)-2-ethenyl-4-propoxyhex-2-enyl]-2-ethylhexane-1,5-diamine (PubChem CID 89038965) has the molecular formula C19H38N2O and a molecular weight of 310.53 g/mol. Its IUPAC name is 1-N-[(E,4R)-2-ethenyl-4-propoxyhex-2-enyl]-2-ethylhexane-1,5-diamine.
| Compound Name | 1-N-[(E,4R)-2-ethenyl-4-propoxyhex-2-enyl]-2-ethylhexane-1,5-diamine |
|---|---|
| PubChem CID | 89038965 |
| Molecular Formula | C19H38N2O |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.30 |
| IUPAC Name | 1-N-[(E,4R)-2-ethenyl-4-propoxyhex-2-enyl]-2-ethylhexane-1,5-diamine |
| SMILES | C=C/C(=C\[C@@H](CC)OCCC)CNCC(CC)CCC(C)N |
| InChI | InChI=1S/C19H38N2O/c1-6-12-22-19(9-4)13-18(8-3)15-21-14-17(7-2)11-10-16(5)20/h8,13,16-17,19,21H,3,6-7,9-12,14-15,20H2,1-2,4-5H3/b18-13+/t16?,17?,19-/m1/s1 |
| InChIKey | WOJLHUKVFZRXGM-OCWCCUNKSA-N |
| XLogP | 4.05 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|