C10H18N2 — CID 89038997
3,6-dimethyl-2-[(Z)-prop-1-enyl]-1,2,3,6-tetrahydropyridin-4-amine (PubChem CID 89038997) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 3,6-dimethyl-2-[(Z)-prop-1-enyl]-1,2,3,6-tetrahydropyridin-4-amine.
| Compound Name | 3,6-dimethyl-2-[(Z)-prop-1-enyl]-1,2,3,6-tetrahydropyridin-4-amine |
|---|---|
| PubChem CID | 89038997 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 3,6-dimethyl-2-[(Z)-prop-1-enyl]-1,2,3,6-tetrahydropyridin-4-amine |
| SMILES | C/C=C\C1NC(C)C=C(N)C1C |
| InChI | InChI=1S/C10H18N2/c1-4-5-10-8(3)9(11)6-7(2)12-10/h4-8,10,12H,11H2,1-3H3/b5-4- |
| InChIKey | ZHFSSBTWQFIEFR-PLNGDYQASA-N |
| XLogP | 1.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|