C19H27NO — CID 89039026
(2E,4Z)-N-(cyclohexa-1,3-dien-1-ylmethyl)-6-cyclopentyloxyhepta-2,4,6-trien-3-amine (PubChem CID 89039026) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is (2E,4Z)-N-(cyclohexa-1,3-dien-1-ylmethyl)-6-cyclopentyloxyhepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z)-N-(cyclohexa-1,3-dien-1-ylmethyl)-6-cyclopentyloxyhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 89039026 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | (2E,4Z)-N-(cyclohexa-1,3-dien-1-ylmethyl)-6-cyclopentyloxyhepta-2,4,6-trien-3-amine |
| SMILES | C=C(/C=C\C(=C/C)NCC1=CC=CCC1)OC1CCCC1 |
| InChI | InChI=1S/C19H27NO/c1-3-18(20-15-17-9-5-4-6-10-17)14-13-16(2)21-19-11-7-8-12-19/h3-5,9,13-14,19-20H,2,6-8,10-12,15H2,1H3/b14-13-,18-3+ |
| InChIKey | QKEOSQUXXUATGK-YZYWILNSSA-N |
| XLogP | 4.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|