About 3-(4-methyl-1,3-dioxetan-2-yl)furan
3-(4-methyl-1,3-dioxetan-2-yl)furan (PubChem CID 89039034) has the molecular formula C7H8O3
and a molecular weight of 140.14 g/mol. Its IUPAC name is 3-(4-methyl-1,3-dioxetan-2-yl)furan.
Molecular Properties
| Compound Name | 3-(4-methyl-1,3-dioxetan-2-yl)furan |
| PubChem CID | 89039034 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | 3-(4-methyl-1,3-dioxetan-2-yl)furan |
| SMILES | CC1OC(c2ccoc2)O1 |
| InChI | InChI=1S/C7H8O3/c1-5-9-7(10-5)6-2-3-8-4-6/h2-5,7H,1H3 |
| InChIKey | ATIQNNTXDMXHRG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-methyl-1,3-dioxetan-2-yl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methyl-1,3-dioxetan-2-yl)furan?
The IUPAC name of 3-(4-methyl-1,3-dioxetan-2-yl)furan (CID 89039034) is 3-(4-methyl-1,3-dioxetan-2-yl)furan.
What is the SMILES notation for 3-(4-methyl-1,3-dioxetan-2-yl)furan?
The canonical SMILES for 3-(4-methyl-1,3-dioxetan-2-yl)furan is CC1OC(c2ccoc2)O1.
What is the InChIKey of 3-(4-methyl-1,3-dioxetan-2-yl)furan?
The InChIKey is ATIQNNTXDMXHRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3/c1-5-9-7(10-5)6-2-3-8-4-6/h2-5,7H,1H3.
What are the key properties of 3-(4-methyl-1,3-dioxetan-2-yl)furan?
3-(4-methyl-1,3-dioxetan-2-yl)furan has a molecular weight of 140.14 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methyl-1,3-dioxetan-2-yl)furan is sourced from PubChem (CID 89039034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).