About 5-fluoro-3-N,3-N-dimethylcyclohex-4-ene-1,3-diamine
5-fluoro-3-N,3-N-dimethylcyclohex-4-ene-1,3-diamine (PubChem CID 89039036) has the molecular formula C8H15FN2
and a molecular weight of 158.22 g/mol. Its IUPAC name is 5-fluoro-3-N,3-N-dimethylcyclohex-4-ene-1,3-diamine.
Molecular Properties
| Compound Name | 5-fluoro-3-N,3-N-dimethylcyclohex-4-ene-1,3-diamine |
| PubChem CID | 89039036 |
| Molecular Formula | C8H15FN2 |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | 5-fluoro-3-N,3-N-dimethylcyclohex-4-ene-1,3-diamine |
| SMILES | CN(C)C1C=C(F)CC(N)C1 |
| InChI | InChI=1S/C8H15FN2/c1-11(2)8-4-6(9)3-7(10)5-8/h4,7-8H,3,5,10H2,1-2H3 |
| InChIKey | YRPBWKARZLVOGR-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-3-N,3-N-dimethylcyclohex-4-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3-N,3-N-dimethylcyclohex-4-ene-1,3-diamine?
The IUPAC name of 5-fluoro-3-N,3-N-dimethylcyclohex-4-ene-1,3-diamine (CID 89039036) is 5-fluoro-3-N,3-N-dimethylcyclohex-4-ene-1,3-diamine.
What is the SMILES notation for 5-fluoro-3-N,3-N-dimethylcyclohex-4-ene-1,3-diamine?
The canonical SMILES for 5-fluoro-3-N,3-N-dimethylcyclohex-4-ene-1,3-diamine is CN(C)C1C=C(F)CC(N)C1.
What is the InChIKey of 5-fluoro-3-N,3-N-dimethylcyclohex-4-ene-1,3-diamine?
The InChIKey is YRPBWKARZLVOGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15FN2/c1-11(2)8-4-6(9)3-7(10)5-8/h4,7-8H,3,5,10H2,1-2H3.
What are the key properties of 5-fluoro-3-N,3-N-dimethylcyclohex-4-ene-1,3-diamine?
5-fluoro-3-N,3-N-dimethylcyclohex-4-ene-1,3-diamine has a molecular weight of 158.22 g/mol, XLogP of 0.89, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3-N,3-N-dimethylcyclohex-4-ene-1,3-diamine is sourced from PubChem (CID 89039036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).