C15H14ClN3O3 — CID 89039446
4-[(7aS)-7-hydroxy-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-2-chloro-3,6-dimethylbenzonitrile (PubChem CID 89039446) has the molecular formula C15H14ClN3O3 and a molecular weight of 319.75 g/mol. Its IUPAC name is 4-[(7aS)-7-hydroxy-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-2-chloro-3,6-dimethylbenzonitrile.
| Compound Name | 4-[(7aS)-7-hydroxy-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-2-chloro-3,6-dimethylbenzonitrile |
|---|---|
| PubChem CID | 89039446 |
| Molecular Formula | C15H14ClN3O3 |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 4-[(7aS)-7-hydroxy-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-2-chloro-3,6-dimethylbenzonitrile |
| SMILES | Cc1cc(N2C(=O)[C@@H]3C(O)CCN3C2=O)c(C)c(Cl)c1C#N |
| InChI | InChI=1S/C15H14ClN3O3/c1-7-5-10(8(2)12(16)9(7)6-17)19-14(21)13-11(20)3-4-18(13)15(19)22/h5,11,13,20H,3-4H2,1-2H3/t11?,13-/m0/s1 |
| InChIKey | KKLDKVSOZHDNCJ-YUZLPWPTSA-N |
| XLogP | 1.73 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|