C18H17BN4O — CID 89039994
CID 89039994 (PubChem CID 89039994) has the molecular formula C18H17BN4O and a molecular weight of 316.17 g/mol.
| Compound Name | CID 89039994 |
|---|---|
| PubChem CID | 89039994 |
| Molecular Formula | C18H17BN4O |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | — |
| SMILES | [B]C(C)c1nc(Nc2cccnc2)cc(-c2cccc(OC)c2)n1 |
| InChI | InChI=1S/C18H17BN4O/c1-12(19)18-22-16(13-5-3-7-15(9-13)24-2)10-17(23-18)21-14-6-4-8-20-11-14/h3-12H,1-2H3,(H,21,22,23) |
| InChIKey | RWNMGNWJRIYUEA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|