C25H37N5O4 — CID 89040286
1-[(E)-[6-(1-hydroxybutyl)-2,3-dihydrochromen-4-ylidene]amino]-3-[1-(4-methylpiperazin-1-yl)butyl]imidazolidine-2,4-dione (PubChem CID 89040286) has the molecular formula C25H37N5O4 and a molecular weight of 471.60 g/mol. Its IUPAC name is 1-[(E)-[6-(1-hydroxybutyl)-2,3-dihydrochromen-4-ylidene]amino]-3-[1-(4-methylpiperazin-1-yl)butyl]imidazolidine-2,4-dione.
| Compound Name | 1-[(E)-[6-(1-hydroxybutyl)-2,3-dihydrochromen-4-ylidene]amino]-3-[1-(4-methylpiperazin-1-yl)butyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 89040286 |
| Molecular Formula | C25H37N5O4 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | 1-[(E)-[6-(1-hydroxybutyl)-2,3-dihydrochromen-4-ylidene]amino]-3-[1-(4-methylpiperazin-1-yl)butyl]imidazolidine-2,4-dione |
| SMILES | CCCC(O)c1ccc2c(c1)/C(=N/N1CC(=O)N(C(CCC)N3CCN(C)CC3)C1=O)CCO2 |
| InChI | InChI=1S/C25H37N5O4/c1-4-6-21(31)18-8-9-22-19(16-18)20(10-15-34-22)26-29-17-24(32)30(25(29)33)23(7-5-2)28-13-11-27(3)12-14-28/h8-9,16,21,23,31H,4-7,10-15,17H2,1-3H3/b26-20+ |
| InChIKey | KKQOWBJXPRFJPL-LHLOQNFPSA-N |
| XLogP | 2.64 |
| TPSA | 88.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|