C30H34O6 — CID 89040358
(5S,13S)-5-cyclohexa-2,4-dien-1-yl-19-ethynyl-13-phenyl-3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(20),17(21),18-trien-21-ol (PubChem CID 89040358) has the molecular formula C30H34O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is (5S,13S)-5-cyclohexa-2,4-dien-1-yl-19-ethynyl-13-phenyl-3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(20),17(21),18-trien-21-ol.
| Compound Name | (5S,13S)-5-cyclohexa-2,4-dien-1-yl-19-ethynyl-13-phenyl-3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(20),17(21),18-trien-21-ol |
|---|---|
| PubChem CID | 89040358 |
| Molecular Formula | C30H34O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | (5S,13S)-5-cyclohexa-2,4-dien-1-yl-19-ethynyl-13-phenyl-3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(20),17(21),18-trien-21-ol |
| SMILES | C#Cc1cc2c(O)c(c1)COC[C@H](C1C=CC=CC1)OCCOCCO[C@@H](c1ccccc1)COC2 |
| InChI | InChI=1S/C30H34O6/c1-2-23-17-26-19-33-21-28(24-9-5-3-6-10-24)35-15-13-32-14-16-36-29(25-11-7-4-8-12-25)22-34-20-27(18-23)30(26)31/h1,3-11,17-18,25,28-29,31H,12-16,19-22H2/t25?,28-,29-/m1/s1 |
| InChIKey | LRZCLKGIWFZHSB-YLOCQQLVSA-N |
| XLogP | 4.71 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|