C19H32O4 — CID 89040365
[1-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-2,3-dimethylpentan-3-yl] 2-methylprop-2-enoate (PubChem CID 89040365) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is [1-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-2,3-dimethylpentan-3-yl] 2-methylprop-2-enoate.
| Compound Name | [1-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-2,3-dimethylpentan-3-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89040365 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | [1-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-2,3-dimethylpentan-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(CC)C(C)COC(C)(CC)C(=O)C(=C)C |
| InChI | InChI=1S/C19H32O4/c1-10-18(8,23-17(21)14(5)6)15(7)12-22-19(9,11-2)16(20)13(3)4/h15H,3,5,10-12H2,1-2,4,6-9H3 |
| InChIKey | PTILVOLIKWIIRN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|