About (10-formyl-5-oxo-2-propan-2-yl-4-oxatricyclo[4.3.1.03,7]decan-2-yl) (E)-but-2-enoate
(10-formyl-5-oxo-2-propan-2-yl-4-oxatricyclo[4.3.1.03,7]decan-2-yl) (E)-but-2-enoate (PubChem CID 89040522) has the molecular formula C17H22O5
and a molecular weight of 306.36 g/mol. Its IUPAC name is (10-formyl-5-oxo-2-propan-2-yl-4-oxatricyclo[4.3.1.03,7]decan-2-yl) (E)-but-2-enoate.
Molecular Properties
| Compound Name | (10-formyl-5-oxo-2-propan-2-yl-4-oxatricyclo[4.3.1.03,7]decan-2-yl) (E)-but-2-enoate |
| PubChem CID | 89040522 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (10-formyl-5-oxo-2-propan-2-yl-4-oxatricyclo[4.3.1.03,7]decan-2-yl) (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OC1(C(C)C)C2CCC3C(C(=O)OC31)C2C=O |
| InChI | InChI=1S/C17H22O5/c1-4-5-13(19)22-17(9(2)3)12-7-6-10-14(11(12)8-18)16(20)21-15(10)17/h4-5,8-12,14-15H,6-7H2,1-3H3/b5-4+ |
| InChIKey | IKOYZELWHHUTKF-SNAWJCMRSA-N |
| XLogP | 1.90 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (10-formyl-5-oxo-2-propan-2-yl-4-oxatricyclo[4.3.1.03,7]decan-2-yl) (E)-but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (10-formyl-5-oxo-2-propan-2-yl-4-oxatricyclo[4.3.1.03,7]decan-2-yl) (E)-but-2-enoate?
The IUPAC name of (10-formyl-5-oxo-2-propan-2-yl-4-oxatricyclo[4.3.1.03,7]decan-2-yl) (E)-but-2-enoate (CID 89040522) is (10-formyl-5-oxo-2-propan-2-yl-4-oxatricyclo[4.3.1.03,7]decan-2-yl) (E)-but-2-enoate.
What is the SMILES notation for (10-formyl-5-oxo-2-propan-2-yl-4-oxatricyclo[4.3.1.03,7]decan-2-yl) (E)-but-2-enoate?
The canonical SMILES for (10-formyl-5-oxo-2-propan-2-yl-4-oxatricyclo[4.3.1.03,7]decan-2-yl) (E)-but-2-enoate is C/C=C/C(=O)OC1(C(C)C)C2CCC3C(C(=O)OC31)C2C=O.
What is the InChIKey of (10-formyl-5-oxo-2-propan-2-yl-4-oxatricyclo[4.3.1.03,7]decan-2-yl) (E)-but-2-enoate?
The InChIKey is IKOYZELWHHUTKF-SNAWJCMRSA-N. The full InChI is InChI=1S/C17H22O5/c1-4-5-13(19)22-17(9(2)3)12-7-6-10-14(11(12)8-18)16(20)21-15(10)17/h4-5,8-12,14-15H,6-7H2,1-3H3/b5-4+.
What are the key properties of (10-formyl-5-oxo-2-propan-2-yl-4-oxatricyclo[4.3.1.03,7]decan-2-yl) (E)-but-2-enoate?
(10-formyl-5-oxo-2-propan-2-yl-4-oxatricyclo[4.3.1.03,7]decan-2-yl) (E)-but-2-enoate has a molecular weight of 306.36 g/mol, XLogP of 1.90, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (10-formyl-5-oxo-2-propan-2-yl-4-oxatricyclo[4.3.1.03,7]decan-2-yl) (E)-but-2-enoate is sourced from PubChem (CID 89040522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).