C11H12FNO2S — CID 89040567
S-[2-fluoro-5-(2-oxoethyl)phenyl] N,N-dimethylcarbamothioate (PubChem CID 89040567) has the molecular formula C11H12FNO2S and a molecular weight of 241.29 g/mol. Its IUPAC name is S-[2-fluoro-5-(2-oxoethyl)phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[2-fluoro-5-(2-oxoethyl)phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 89040567 |
| Molecular Formula | C11H12FNO2S |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | S-[2-fluoro-5-(2-oxoethyl)phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1cc(CC=O)ccc1F |
| InChI | InChI=1S/C11H12FNO2S/c1-13(2)11(15)16-10-7-8(5-6-14)3-4-9(10)12/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | DDMZQUIPUCCFAG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|