About 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyridine
5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyridine (PubChem CID 89041208) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyridine.
Analyze 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyridine?
The IUPAC name of 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyridine (CID 89041208) is 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyridine.
What is the SMILES notation for 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyridine?
The canonical SMILES for 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyridine is CC1=C(C(C)C)NCCC1.
What is the InChIKey of 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyridine?
The InChIKey is GGGMTZYGSSBFKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c1-7(2)9-8(3)5-4-6-10-9/h7,10H,4-6H2,1-3H3.
What are the key properties of 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyridine?
5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyridine has a molecular weight of 139.24 g/mol, XLogP of 2.30, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyridine is sourced from PubChem (CID 89041208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).