About 6-methyl-5-propan-2-yl-1,2,3,4-tetrahydropyridine
6-methyl-5-propan-2-yl-1,2,3,4-tetrahydropyridine (PubChem CID 89041215) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is 6-methyl-5-propan-2-yl-1,2,3,4-tetrahydropyridine.
Analyze 6-methyl-5-propan-2-yl-1,2,3,4-tetrahydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5-propan-2-yl-1,2,3,4-tetrahydropyridine?
The IUPAC name of 6-methyl-5-propan-2-yl-1,2,3,4-tetrahydropyridine (CID 89041215) is 6-methyl-5-propan-2-yl-1,2,3,4-tetrahydropyridine.
What is the SMILES notation for 6-methyl-5-propan-2-yl-1,2,3,4-tetrahydropyridine?
The canonical SMILES for 6-methyl-5-propan-2-yl-1,2,3,4-tetrahydropyridine is CC1=C(C(C)C)CCCN1.
What is the InChIKey of 6-methyl-5-propan-2-yl-1,2,3,4-tetrahydropyridine?
The InChIKey is DIZNMZFYTWUUOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c1-7(2)9-5-4-6-10-8(9)3/h7,10H,4-6H2,1-3H3.
What are the key properties of 6-methyl-5-propan-2-yl-1,2,3,4-tetrahydropyridine?
6-methyl-5-propan-2-yl-1,2,3,4-tetrahydropyridine has a molecular weight of 139.24 g/mol, XLogP of 2.30, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5-propan-2-yl-1,2,3,4-tetrahydropyridine is sourced from PubChem (CID 89041215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).