About 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyrazine
5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyrazine (PubChem CID 89041221) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyrazine.
Analyze 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyrazine?
The IUPAC name of 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyrazine (CID 89041221) is 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyrazine.
What is the SMILES notation for 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyrazine?
The canonical SMILES for 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyrazine is CC1=C(C(C)C)NCCN1.
What is the InChIKey of 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyrazine?
The InChIKey is CZCILZCPHGNFFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2/c1-6(2)8-7(3)9-4-5-10-8/h6,9-10H,4-5H2,1-3H3.
What are the key properties of 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyrazine?
5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyrazine has a molecular weight of 140.23 g/mol, XLogP of 1.07, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydropyrazine is sourced from PubChem (CID 89041221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).