About 5-methyl-4,4a-dihydropyrido[2,3-c]pyridazine
5-methyl-4,4a-dihydropyrido[2,3-c]pyridazine (PubChem CID 89041249) has the molecular formula C8H9N3
and a molecular weight of 147.18 g/mol. Its IUPAC name is 5-methyl-4,4a-dihydropyrido[2,3-c]pyridazine.
Molecular Properties
| Compound Name | 5-methyl-4,4a-dihydropyrido[2,3-c]pyridazine |
| PubChem CID | 89041249 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 5-methyl-4,4a-dihydropyrido[2,3-c]pyridazine |
| SMILES | CC1=CC=NC2=NN=CCC12 |
| InChI | InChI=1S/C8H9N3/c1-6-2-4-9-8-7(6)3-5-10-11-8/h2,4-5,7H,3H2,1H3 |
| InChIKey | OSBBCCXEENABOZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-4,4a-dihydropyrido[2,3-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4,4a-dihydropyrido[2,3-c]pyridazine?
The IUPAC name of 5-methyl-4,4a-dihydropyrido[2,3-c]pyridazine (CID 89041249) is 5-methyl-4,4a-dihydropyrido[2,3-c]pyridazine.
What is the SMILES notation for 5-methyl-4,4a-dihydropyrido[2,3-c]pyridazine?
The canonical SMILES for 5-methyl-4,4a-dihydropyrido[2,3-c]pyridazine is CC1=CC=NC2=NN=CCC12.
What is the InChIKey of 5-methyl-4,4a-dihydropyrido[2,3-c]pyridazine?
The InChIKey is OSBBCCXEENABOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3/c1-6-2-4-9-8-7(6)3-5-10-11-8/h2,4-5,7H,3H2,1H3.
What are the key properties of 5-methyl-4,4a-dihydropyrido[2,3-c]pyridazine?
5-methyl-4,4a-dihydropyrido[2,3-c]pyridazine has a molecular weight of 147.18 g/mol, XLogP of 1.42, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4,4a-dihydropyrido[2,3-c]pyridazine is sourced from PubChem (CID 89041249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).