C19H34O3 — CID 89042002
3-[(2R,8S)-3-methyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]propan-1-ol (PubChem CID 89042002) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is 3-[(2R,8S)-3-methyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]propan-1-ol.
| Compound Name | 3-[(2R,8S)-3-methyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 89042002 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | 3-[(2R,8S)-3-methyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]propan-1-ol |
| SMILES | C=C[C@@H](C)CC[C@@H]1CCCC2(CCC(C)[C@@H](CCCO)O2)O1 |
| InChI | InChI=1S/C19H34O3/c1-4-15(2)9-10-17-7-5-12-19(21-17)13-11-16(3)18(22-19)8-6-14-20/h4,15-18,20H,1,5-14H2,2-3H3/t15-,16?,17+,18-,19?/m1/s1 |
| InChIKey | VZAZVJQJHJTESF-QASGIJCMSA-N |
| XLogP | 4.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|