About N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4,4-dimethylpentanamide
N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4,4-dimethylpentanamide (PubChem CID 89042020) has the molecular formula C12H25NO3
and a molecular weight of 231.34 g/mol. Its IUPAC name is N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4,4-dimethylpentanamide.
Molecular Properties
| Compound Name | N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4,4-dimethylpentanamide |
| PubChem CID | 89042020 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4,4-dimethylpentanamide |
| SMILES | CCC(CO)(CO)NC(=O)CCC(C)(C)C |
| InChI | InChI=1S/C12H25NO3/c1-5-12(8-14,9-15)13-10(16)6-7-11(2,3)4/h14-15H,5-9H2,1-4H3,(H,13,16) |
| InChIKey | MWBHEVLOBPTSMA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4,4-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4,4-dimethylpentanamide?
The IUPAC name of N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4,4-dimethylpentanamide (CID 89042020) is N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4,4-dimethylpentanamide.
What is the SMILES notation for N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4,4-dimethylpentanamide?
The canonical SMILES for N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4,4-dimethylpentanamide is CCC(CO)(CO)NC(=O)CCC(C)(C)C.
What is the InChIKey of N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4,4-dimethylpentanamide?
The InChIKey is MWBHEVLOBPTSMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO3/c1-5-12(8-14,9-15)13-10(16)6-7-11(2,3)4/h14-15H,5-9H2,1-4H3,(H,13,16).
What are the key properties of N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4,4-dimethylpentanamide?
N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4,4-dimethylpentanamide has a molecular weight of 231.34 g/mol, XLogP of 1.06, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4,4-dimethylpentanamide is sourced from PubChem (CID 89042020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).