C12H19N — CID 89042044
2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-methylpyrrolidine (PubChem CID 89042044) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-methylpyrrolidine.
| Compound Name | 2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-methylpyrrolidine |
|---|---|
| PubChem CID | 89042044 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-methylpyrrolidine |
| SMILES | C=C/C=C\C(=C/C)C1CCCN1C |
| InChI | InChI=1S/C12H19N/c1-4-6-8-11(5-2)12-9-7-10-13(12)3/h4-6,8,12H,1,7,9-10H2,2-3H3/b8-6-,11-5+ |
| InChIKey | ADUKVOQDKXDWRD-QHPKLMRPSA-N |
| XLogP | 2.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|