About 2-(iodomethyl)-4-nitroso-1,3-benzoxazole
2-(iodomethyl)-4-nitroso-1,3-benzoxazole (PubChem CID 89042202) has the molecular formula C8H5IN2O2
and a molecular weight of 288.04 g/mol. Its IUPAC name is 2-(iodomethyl)-4-nitroso-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-(iodomethyl)-4-nitroso-1,3-benzoxazole |
| PubChem CID | 89042202 |
| Molecular Formula | C8H5IN2O2 |
| Molecular Weight | 288.04 g/mol |
| Exact Mass | 287.94 |
| IUPAC Name | 2-(iodomethyl)-4-nitroso-1,3-benzoxazole |
| SMILES | O=Nc1cccc2oc(CI)nc12 |
| InChI | InChI=1S/C8H5IN2O2/c9-4-7-10-8-5(11-12)2-1-3-6(8)13-7/h1-3H,4H2 |
| InChIKey | SUUYZIBHAHETOG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.04 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(iodomethyl)-4-nitroso-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(iodomethyl)-4-nitroso-1,3-benzoxazole?
The IUPAC name of 2-(iodomethyl)-4-nitroso-1,3-benzoxazole (CID 89042202) is 2-(iodomethyl)-4-nitroso-1,3-benzoxazole.
What is the SMILES notation for 2-(iodomethyl)-4-nitroso-1,3-benzoxazole?
The canonical SMILES for 2-(iodomethyl)-4-nitroso-1,3-benzoxazole is O=Nc1cccc2oc(CI)nc12.
What is the InChIKey of 2-(iodomethyl)-4-nitroso-1,3-benzoxazole?
The InChIKey is SUUYZIBHAHETOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5IN2O2/c9-4-7-10-8-5(11-12)2-1-3-6(8)13-7/h1-3H,4H2.
What are the key properties of 2-(iodomethyl)-4-nitroso-1,3-benzoxazole?
2-(iodomethyl)-4-nitroso-1,3-benzoxazole has a molecular weight of 288.04 g/mol, XLogP of 3.16, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(iodomethyl)-4-nitroso-1,3-benzoxazole is sourced from PubChem (CID 89042202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).