C13H14BN3O2 — CID 89042397
CID 89042397 (PubChem CID 89042397) has the molecular formula C13H14BN3O2 and a molecular weight of 255.09 g/mol.
| Compound Name | CID 89042397 |
|---|---|
| PubChem CID | 89042397 |
| Molecular Formula | C13H14BN3O2 |
| Molecular Weight | 255.09 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | — |
| SMILES | [B]N1CCC[C@H]1c1nc2ccc(C(=O)OC)cc2[nH]1 |
| InChI | InChI=1S/C13H14BN3O2/c1-19-13(18)8-4-5-9-10(7-8)16-12(15-9)11-3-2-6-17(11)14/h4-5,7,11H,2-3,6H2,1H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | ZQFIWEOLRBLVLX-NSHDSACASA-N |
| XLogP | 1.57 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.09 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|