C24H43NO9 — CID 89043077
N-[[(2R,3R,4S,6R)-6-[(2S)-2,3-dihydroxypropyl]-3-(hydroxymethoxy)-4-methoxy-5,5-dimethyloxan-2-yl]methyl]-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide (PubChem CID 89043077) has the molecular formula C24H43NO9 and a molecular weight of 489.61 g/mol. Its IUPAC name is N-[[(2R,3R,4S,6R)-6-[(2S)-2,3-dihydroxypropyl]-3-(hydroxymethoxy)-4-methoxy-5,5-dimethyloxan-2-yl]methyl]-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide.
| Compound Name | N-[[(2R,3R,4S,6R)-6-[(2S)-2,3-dihydroxypropyl]-3-(hydroxymethoxy)-4-methoxy-5,5-dimethyloxan-2-yl]methyl]-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide |
|---|---|
| PubChem CID | 89043077 |
| Molecular Formula | C24H43NO9 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | N-[[(2R,3R,4S,6R)-6-[(2S)-2,3-dihydroxypropyl]-3-(hydroxymethoxy)-4-methoxy-5,5-dimethyloxan-2-yl]methyl]-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide |
| SMILES | C=C1C[C@@](CC(=O)NC[C@H]2O[C@H](C[C@H](O)CO)C(C)(C)[C@H](OC)[C@H]2OCO)(OC)O[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C24H43NO9/c1-14-9-24(31-7,34-16(3)15(14)2)10-20(29)25-11-18-21(32-13-27)22(30-6)23(4,5)19(33-18)8-17(28)12-26/h15-19,21-22,26-28H,1,8-13H2,2-7H3,(H,25,29)/t15-,16-,17+,18-,19-,21+,22-,24-/m1/s1 |
| InChIKey | PVGXDKWTJAYWED-OIFWGGTNSA-N |
| XLogP | 0.72 |
| TPSA | 135.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|