C24H45NO7 — CID 89043078
(2S)-2-hydroxy-N-[(4R,6R)-4-hydroxy-6,9-dimethoxy-5,5-dimethylnonyl]-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide (PubChem CID 89043078) has the molecular formula C24H45NO7 and a molecular weight of 459.62 g/mol. Its IUPAC name is (2S)-2-hydroxy-N-[(4R,6R)-4-hydroxy-6,9-dimethoxy-5,5-dimethylnonyl]-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide.
| Compound Name | (2S)-2-hydroxy-N-[(4R,6R)-4-hydroxy-6,9-dimethoxy-5,5-dimethylnonyl]-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide |
|---|---|
| PubChem CID | 89043078 |
| Molecular Formula | C24H45NO7 |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.32 |
| IUPAC Name | (2S)-2-hydroxy-N-[(4R,6R)-4-hydroxy-6,9-dimethoxy-5,5-dimethylnonyl]-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide |
| SMILES | C=C1C[C@](OC)([C@H](O)C(=O)NCCC[C@@H](O)C(C)(C)[C@@H](CCCOC)OC)O[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C24H45NO7/c1-16-15-24(31-8,32-18(3)17(16)2)21(27)22(28)25-13-9-11-19(26)23(4,5)20(30-7)12-10-14-29-6/h17-21,26-27H,1,9-15H2,2-8H3,(H,25,28)/t17-,18-,19-,20-,21-,24-/m1/s1 |
| InChIKey | CAOHMUGOXKUIDY-MQJSGXSGSA-N |
| XLogP | 2.42 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|