About (4Z)-1-(2-aminoethoxy)hepta-4,6-dien-3-amine
(4Z)-1-(2-aminoethoxy)hepta-4,6-dien-3-amine (PubChem CID 89043467) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is (4Z)-1-(2-aminoethoxy)hepta-4,6-dien-3-amine.
Molecular Properties
| Compound Name | (4Z)-1-(2-aminoethoxy)hepta-4,6-dien-3-amine |
| PubChem CID | 89043467 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | (4Z)-1-(2-aminoethoxy)hepta-4,6-dien-3-amine |
| SMILES | C=C/C=C\C(N)CCOCCN |
| InChI | InChI=1S/C9H18N2O/c1-2-3-4-9(11)5-7-12-8-6-10/h2-4,9H,1,5-8,10-11H2/b4-3- |
| InChIKey | XNJMOLOQNPBZKW-ARJAWSKDSA-N |
| XLogP | 0.42 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-1-(2-aminoethoxy)hepta-4,6-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-1-(2-aminoethoxy)hepta-4,6-dien-3-amine?
The IUPAC name of (4Z)-1-(2-aminoethoxy)hepta-4,6-dien-3-amine (CID 89043467) is (4Z)-1-(2-aminoethoxy)hepta-4,6-dien-3-amine.
What is the SMILES notation for (4Z)-1-(2-aminoethoxy)hepta-4,6-dien-3-amine?
The canonical SMILES for (4Z)-1-(2-aminoethoxy)hepta-4,6-dien-3-amine is C=C/C=C\C(N)CCOCCN.
What is the InChIKey of (4Z)-1-(2-aminoethoxy)hepta-4,6-dien-3-amine?
The InChIKey is XNJMOLOQNPBZKW-ARJAWSKDSA-N. The full InChI is InChI=1S/C9H18N2O/c1-2-3-4-9(11)5-7-12-8-6-10/h2-4,9H,1,5-8,10-11H2/b4-3-.
What are the key properties of (4Z)-1-(2-aminoethoxy)hepta-4,6-dien-3-amine?
(4Z)-1-(2-aminoethoxy)hepta-4,6-dien-3-amine has a molecular weight of 170.26 g/mol, XLogP of 0.42, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-1-(2-aminoethoxy)hepta-4,6-dien-3-amine is sourced from PubChem (CID 89043467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).