About [4-(3-phenylbuta-1,3-dien-2-yl)cyclohexa-2,4-dien-1-yl]methanamine
[4-(3-phenylbuta-1,3-dien-2-yl)cyclohexa-2,4-dien-1-yl]methanamine (PubChem CID 89044109) has the molecular formula C17H19N
and a molecular weight of 237.35 g/mol. Its IUPAC name is [4-(3-phenylbuta-1,3-dien-2-yl)cyclohexa-2,4-dien-1-yl]methanamine.
Molecular Properties
| Compound Name | [4-(3-phenylbuta-1,3-dien-2-yl)cyclohexa-2,4-dien-1-yl]methanamine |
| PubChem CID | 89044109 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | [4-(3-phenylbuta-1,3-dien-2-yl)cyclohexa-2,4-dien-1-yl]methanamine |
| SMILES | C=C(C(=C)c1ccccc1)C1=CCC(CN)C=C1 |
| InChI | InChI=1S/C17H19N/c1-13(16-6-4-3-5-7-16)14(2)17-10-8-15(12-18)9-11-17/h3-8,10-11,15H,1-2,9,12,18H2 |
| InChIKey | SVNOPMLKIYSAIQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [4-(3-phenylbuta-1,3-dien-2-yl)cyclohexa-2,4-dien-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-phenylbuta-1,3-dien-2-yl)cyclohexa-2,4-dien-1-yl]methanamine?
The IUPAC name of [4-(3-phenylbuta-1,3-dien-2-yl)cyclohexa-2,4-dien-1-yl]methanamine (CID 89044109) is [4-(3-phenylbuta-1,3-dien-2-yl)cyclohexa-2,4-dien-1-yl]methanamine.
What is the SMILES notation for [4-(3-phenylbuta-1,3-dien-2-yl)cyclohexa-2,4-dien-1-yl]methanamine?
The canonical SMILES for [4-(3-phenylbuta-1,3-dien-2-yl)cyclohexa-2,4-dien-1-yl]methanamine is C=C(C(=C)c1ccccc1)C1=CCC(CN)C=C1.
What is the InChIKey of [4-(3-phenylbuta-1,3-dien-2-yl)cyclohexa-2,4-dien-1-yl]methanamine?
The InChIKey is SVNOPMLKIYSAIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N/c1-13(16-6-4-3-5-7-16)14(2)17-10-8-15(12-18)9-11-17/h3-8,10-11,15H,1-2,9,12,18H2.
What are the key properties of [4-(3-phenylbuta-1,3-dien-2-yl)cyclohexa-2,4-dien-1-yl]methanamine?
[4-(3-phenylbuta-1,3-dien-2-yl)cyclohexa-2,4-dien-1-yl]methanamine has a molecular weight of 237.35 g/mol, XLogP of 3.72, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-phenylbuta-1,3-dien-2-yl)cyclohexa-2,4-dien-1-yl]methanamine is sourced from PubChem (CID 89044109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).