About (6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanamine
(6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanamine (PubChem CID 89044124) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is (6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanamine.
Molecular Properties
| Compound Name | (6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanamine |
| PubChem CID | 89044124 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | (6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanamine |
| SMILES | CSC1=CCCC=C1CN |
| InChI | InChI=1S/C8H13NS/c1-10-8-5-3-2-4-7(8)6-9/h4-5H,2-3,6,9H2,1H3 |
| InChIKey | VMOHMKAFEDFLJB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanamine?
The IUPAC name of (6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanamine (CID 89044124) is (6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanamine.
What is the SMILES notation for (6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanamine?
The canonical SMILES for (6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanamine is CSC1=CCCC=C1CN.
What is the InChIKey of (6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanamine?
The InChIKey is VMOHMKAFEDFLJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NS/c1-10-8-5-3-2-4-7(8)6-9/h4-5H,2-3,6,9H2,1H3.
What are the key properties of (6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanamine?
(6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanamine has a molecular weight of 155.27 g/mol, XLogP of 1.91, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methylsulfanylcyclohexa-1,5-dien-1-yl)methanamine is sourced from PubChem (CID 89044124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).