C23H21N5O — CID 89044132
4-[7-(cyclobutylamino)-2-methyl-6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]benzaldehyde (PubChem CID 89044132) has the molecular formula C23H21N5O and a molecular weight of 383.46 g/mol. Its IUPAC name is 4-[7-(cyclobutylamino)-2-methyl-6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]benzaldehyde.
| Compound Name | 4-[7-(cyclobutylamino)-2-methyl-6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]benzaldehyde |
|---|---|
| PubChem CID | 89044132 |
| Molecular Formula | C23H21N5O |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 4-[7-(cyclobutylamino)-2-methyl-6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]benzaldehyde |
| SMILES | Cc1nc2nc(-c3ccc(C=O)cc3)c(-c3ccccc3)c(NC3CCC3)n2n1 |
| InChI | InChI=1S/C23H21N5O/c1-15-24-23-26-21(18-12-10-16(14-29)11-13-18)20(17-6-3-2-4-7-17)22(28(23)27-15)25-19-8-5-9-19/h2-4,6-7,10-14,19,25H,5,8-9H2,1H3 |
| InChIKey | ODPDJJSCIVHOSL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|