C9H6INO2 — CID 89044421
7-amino-3λ3-iodabicyclo[4.4.0]deca-1(6),3,7,9-tetraene-2,5-dione (PubChem CID 89044421) has the molecular formula C9H6INO2 and a molecular weight of 287.06 g/mol. Its IUPAC name is 7-amino-3λ3-iodabicyclo[4.4.0]deca-1(6),3,7,9-tetraene-2,5-dione.
| Compound Name | 7-amino-3λ3-iodabicyclo[4.4.0]deca-1(6),3,7,9-tetraene-2,5-dione |
|---|---|
| PubChem CID | 89044421 |
| Molecular Formula | C9H6INO2 |
| Molecular Weight | 287.06 g/mol |
| Exact Mass | 286.94 |
| IUPAC Name | 7-amino-3λ3-iodabicyclo[4.4.0]deca-1(6),3,7,9-tetraene-2,5-dione |
| SMILES | Nc1cccc2c1C(=O)C=IC2=O |
| InChI | InChI=1S/C9H6INO2/c11-6-3-1-2-5-8(6)7(12)4-10-9(5)13/h1-4H,11H2 |
| InChIKey | BVWQZDBRKVYOHO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.06 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|