C24H29NO7 — CID 89044455
[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl] N-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]carbamate (PubChem CID 89044455) has the molecular formula C24H29NO7 and a molecular weight of 443.50 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl] N-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]carbamate.
| Compound Name | [(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl] N-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]carbamate |
|---|---|
| PubChem CID | 89044455 |
| Molecular Formula | C24H29NO7 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl] N-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]carbamate |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](OC(=O)Nc2ccc(/C=C/c3ccc(O)cc3)cc2)[C@@H]1OC |
| InChI | InChI=1S/C24H29NO7/c1-15-20(28-2)21(29-3)22(30-4)23(31-15)32-24(27)25-18-11-7-16(8-12-18)5-6-17-9-13-19(26)14-10-17/h5-15,20-23,26H,1-4H3,(H,25,27)/b6-5+/t15-,20-,21+,22+,23-/m0/s1 |
| InChIKey | TUTUHZNQHRGWQQ-GHYZBFPZSA-N |
| XLogP | 3.90 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|