C10H16N2 — CID 89044535
(8S)-N-methyl-4,4a,5,6,7,8-hexahydroquinolin-8-amine (PubChem CID 89044535) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (8S)-N-methyl-4,4a,5,6,7,8-hexahydroquinolin-8-amine.
| Compound Name | (8S)-N-methyl-4,4a,5,6,7,8-hexahydroquinolin-8-amine |
|---|---|
| PubChem CID | 89044535 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (8S)-N-methyl-4,4a,5,6,7,8-hexahydroquinolin-8-amine |
| SMILES | CN[C@H]1CCCC2CC=CN=C21 |
| InChI | InChI=1S/C10H16N2/c1-11-9-6-2-4-8-5-3-7-12-10(8)9/h3,7-9,11H,2,4-6H2,1H3/t8?,9-/m0/s1 |
| InChIKey | RFMJCSBRUFCDBL-GKAPJAKFSA-N |
| XLogP | 1.73 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |