About [3-[3-(1-methoxyethoxy)-3-oxopropoxy]-3-oxopropyl] 2-tert-butyl-2,4,4-trimethylpentanoate
[3-[3-(1-methoxyethoxy)-3-oxopropoxy]-3-oxopropyl] 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 89044685) has the molecular formula C21H38O7
and a molecular weight of 402.53 g/mol. Its IUPAC name is [3-[3-(1-methoxyethoxy)-3-oxopropoxy]-3-oxopropyl] 2-tert-butyl-2,4,4-trimethylpentanoate.
Molecular Properties
| Compound Name | [3-[3-(1-methoxyethoxy)-3-oxopropoxy]-3-oxopropyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
| PubChem CID | 89044685 |
| Molecular Formula | C21H38O7 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | [3-[3-(1-methoxyethoxy)-3-oxopropoxy]-3-oxopropyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | COC(C)OC(=O)CCOC(=O)CCOC(=O)C(C)(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C21H38O7/c1-15(25-9)28-17(23)11-12-26-16(22)10-13-27-18(24)21(8,20(5,6)7)14-19(2,3)4/h15H,10-14H2,1-9H3 |
| InChIKey | WLNKMUCDOORSPC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [3-[3-(1-methoxyethoxy)-3-oxopropoxy]-3-oxopropyl] 2-tert-butyl-2,4,4-trimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[3-(1-methoxyethoxy)-3-oxopropoxy]-3-oxopropyl] 2-tert-butyl-2,4,4-trimethylpentanoate?
The IUPAC name of [3-[3-(1-methoxyethoxy)-3-oxopropoxy]-3-oxopropyl] 2-tert-butyl-2,4,4-trimethylpentanoate (CID 89044685) is [3-[3-(1-methoxyethoxy)-3-oxopropoxy]-3-oxopropyl] 2-tert-butyl-2,4,4-trimethylpentanoate.
What is the SMILES notation for [3-[3-(1-methoxyethoxy)-3-oxopropoxy]-3-oxopropyl] 2-tert-butyl-2,4,4-trimethylpentanoate?
The canonical SMILES for [3-[3-(1-methoxyethoxy)-3-oxopropoxy]-3-oxopropyl] 2-tert-butyl-2,4,4-trimethylpentanoate is COC(C)OC(=O)CCOC(=O)CCOC(=O)C(C)(CC(C)(C)C)C(C)(C)C.
What is the InChIKey of [3-[3-(1-methoxyethoxy)-3-oxopropoxy]-3-oxopropyl] 2-tert-butyl-2,4,4-trimethylpentanoate?
The InChIKey is WLNKMUCDOORSPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38O7/c1-15(25-9)28-17(23)11-12-26-16(22)10-13-27-18(24)21(8,20(5,6)7)14-19(2,3)4/h15H,10-14H2,1-9H3.
What are the key properties of [3-[3-(1-methoxyethoxy)-3-oxopropoxy]-3-oxopropyl] 2-tert-butyl-2,4,4-trimethylpentanoate?
[3-[3-(1-methoxyethoxy)-3-oxopropoxy]-3-oxopropyl] 2-tert-butyl-2,4,4-trimethylpentanoate has a molecular weight of 402.53 g/mol, XLogP of 3.88, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[3-(1-methoxyethoxy)-3-oxopropoxy]-3-oxopropyl] 2-tert-butyl-2,4,4-trimethylpentanoate is sourced from PubChem (CID 89044685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).