C21H19F3N4O — CID 89044865
3-(1-anilino-3-iminobutyl)-1-[3-(trifluoromethyl)phenyl]pyridazin-4-one (PubChem CID 89044865) has the molecular formula C21H19F3N4O and a molecular weight of 400.40 g/mol. Its IUPAC name is 3-(1-anilino-3-iminobutyl)-1-[3-(trifluoromethyl)phenyl]pyridazin-4-one.
| Compound Name | 3-(1-anilino-3-iminobutyl)-1-[3-(trifluoromethyl)phenyl]pyridazin-4-one |
|---|---|
| PubChem CID | 89044865 |
| Molecular Formula | C21H19F3N4O |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 3-(1-anilino-3-iminobutyl)-1-[3-(trifluoromethyl)phenyl]pyridazin-4-one |
| SMILES | [H]/N=C(\C)CC(Nc1ccccc1)c1nn(-c2cccc(C(F)(F)F)c2)ccc1=O |
| InChI | InChI=1S/C21H19F3N4O/c1-14(25)12-18(26-16-7-3-2-4-8-16)20-19(29)10-11-28(27-20)17-9-5-6-15(13-17)21(22,23)24/h2-11,13,18,25-26H,12H2,1H3/b25-14+ |
| InChIKey | SNIRUBSWODJEDH-AFUMVMLFSA-N |
| XLogP | 4.83 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|