About 4,4-dimethyl-3-oxo-N-(11-tricyclo[5.3.1.03,9]undecanyl)pentanamide
4,4-dimethyl-3-oxo-N-(11-tricyclo[5.3.1.03,9]undecanyl)pentanamide (PubChem CID 89044870) has the molecular formula C18H29NO2
and a molecular weight of 291.43 g/mol. Its IUPAC name is 4,4-dimethyl-3-oxo-N-(11-tricyclo[5.3.1.03,9]undecanyl)pentanamide.
Molecular Properties
| Compound Name | 4,4-dimethyl-3-oxo-N-(11-tricyclo[5.3.1.03,9]undecanyl)pentanamide |
| PubChem CID | 89044870 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.43 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 4,4-dimethyl-3-oxo-N-(11-tricyclo[5.3.1.03,9]undecanyl)pentanamide |
| SMILES | CC(C)(C)C(=O)CC(=O)NC1C2CCCC3CC1CC3C2 |
| InChI | InChI=1S/C18H29NO2/c1-18(2,3)15(20)10-16(21)19-17-12-6-4-5-11-7-14(17)9-13(11)8-12/h11-14,17H,4-10H2,1-3H3,(H,19,21) |
| InChIKey | NYXMTZBFPUUXJH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethyl-3-oxo-N-(11-tricyclo[5.3.1.03,9]undecanyl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-3-oxo-N-(11-tricyclo[5.3.1.03,9]undecanyl)pentanamide?
The IUPAC name of 4,4-dimethyl-3-oxo-N-(11-tricyclo[5.3.1.03,9]undecanyl)pentanamide (CID 89044870) is 4,4-dimethyl-3-oxo-N-(11-tricyclo[5.3.1.03,9]undecanyl)pentanamide.
What is the SMILES notation for 4,4-dimethyl-3-oxo-N-(11-tricyclo[5.3.1.03,9]undecanyl)pentanamide?
The canonical SMILES for 4,4-dimethyl-3-oxo-N-(11-tricyclo[5.3.1.03,9]undecanyl)pentanamide is CC(C)(C)C(=O)CC(=O)NC1C2CCCC3CC1CC3C2.
What is the InChIKey of 4,4-dimethyl-3-oxo-N-(11-tricyclo[5.3.1.03,9]undecanyl)pentanamide?
The InChIKey is NYXMTZBFPUUXJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO2/c1-18(2,3)15(20)10-16(21)19-17-12-6-4-5-11-7-14(17)9-13(11)8-12/h11-14,17H,4-10H2,1-3H3,(H,19,21).
What are the key properties of 4,4-dimethyl-3-oxo-N-(11-tricyclo[5.3.1.03,9]undecanyl)pentanamide?
4,4-dimethyl-3-oxo-N-(11-tricyclo[5.3.1.03,9]undecanyl)pentanamide has a molecular weight of 291.43 g/mol, XLogP of 3.32, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-3-oxo-N-(11-tricyclo[5.3.1.03,9]undecanyl)pentanamide is sourced from PubChem (CID 89044870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).