About 2-(4-chlorocyclohexa-1,3-dien-1-yl)oxyacetaldehyde
2-(4-chlorocyclohexa-1,3-dien-1-yl)oxyacetaldehyde (PubChem CID 89044915) has the molecular formula C8H9ClO2
and a molecular weight of 172.61 g/mol. Its IUPAC name is 2-(4-chlorocyclohexa-1,3-dien-1-yl)oxyacetaldehyde.
Molecular Properties
| Compound Name | 2-(4-chlorocyclohexa-1,3-dien-1-yl)oxyacetaldehyde |
| PubChem CID | 89044915 |
| Molecular Formula | C8H9ClO2 |
| Molecular Weight | 172.61 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 2-(4-chlorocyclohexa-1,3-dien-1-yl)oxyacetaldehyde |
| SMILES | O=CCOC1=CC=C(Cl)CC1 |
| InChI | InChI=1S/C8H9ClO2/c9-7-1-3-8(4-2-7)11-6-5-10/h1,3,5H,2,4,6H2 |
| InChIKey | AEOGGPOWSPHWHC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.61 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorocyclohexa-1,3-dien-1-yl)oxyacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorocyclohexa-1,3-dien-1-yl)oxyacetaldehyde?
The IUPAC name of 2-(4-chlorocyclohexa-1,3-dien-1-yl)oxyacetaldehyde (CID 89044915) is 2-(4-chlorocyclohexa-1,3-dien-1-yl)oxyacetaldehyde.
What is the SMILES notation for 2-(4-chlorocyclohexa-1,3-dien-1-yl)oxyacetaldehyde?
The canonical SMILES for 2-(4-chlorocyclohexa-1,3-dien-1-yl)oxyacetaldehyde is O=CCOC1=CC=C(Cl)CC1.
What is the InChIKey of 2-(4-chlorocyclohexa-1,3-dien-1-yl)oxyacetaldehyde?
The InChIKey is AEOGGPOWSPHWHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClO2/c9-7-1-3-8(4-2-7)11-6-5-10/h1,3,5H,2,4,6H2.
What are the key properties of 2-(4-chlorocyclohexa-1,3-dien-1-yl)oxyacetaldehyde?
2-(4-chlorocyclohexa-1,3-dien-1-yl)oxyacetaldehyde has a molecular weight of 172.61 g/mol, XLogP of 2.00, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorocyclohexa-1,3-dien-1-yl)oxyacetaldehyde is sourced from PubChem (CID 89044915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).