C19H18Cl2FNO3 — CID 89044960
(2S,3R)-2-(3,4-dichlorophenyl)-3-[2-fluoro-4-(oxan-4-yloxy)phenyl]-1-hydroxyaziridine (PubChem CID 89044960) has the molecular formula C19H18Cl2FNO3 and a molecular weight of 398.26 g/mol. Its IUPAC name is (2S,3R)-2-(3,4-dichlorophenyl)-3-[2-fluoro-4-(oxan-4-yloxy)phenyl]-1-hydroxyaziridine.
| Compound Name | (2S,3R)-2-(3,4-dichlorophenyl)-3-[2-fluoro-4-(oxan-4-yloxy)phenyl]-1-hydroxyaziridine |
|---|---|
| PubChem CID | 89044960 |
| Molecular Formula | C19H18Cl2FNO3 |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | (2S,3R)-2-(3,4-dichlorophenyl)-3-[2-fluoro-4-(oxan-4-yloxy)phenyl]-1-hydroxyaziridine |
| SMILES | ON1[C@H](c2ccc(OC3CCOCC3)cc2F)[C@@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H18Cl2FNO3/c20-15-4-1-11(9-16(15)21)18-19(23(18)24)14-3-2-13(10-17(14)22)26-12-5-7-25-8-6-12/h1-4,9-10,12,18-19,24H,5-8H2/t18-,19+,23?/m0/s1 |
| InChIKey | ZDRCNVOQQGYRTE-HXIJRHRVSA-N |
| XLogP | 5.18 |
| TPSA | 41.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|