About N-(2-hydrazinylethyl)-3-methylcyclohexa-1,5-dien-1-amine
N-(2-hydrazinylethyl)-3-methylcyclohexa-1,5-dien-1-amine (PubChem CID 89045039) has the molecular formula C9H17N3
and a molecular weight of 167.26 g/mol. Its IUPAC name is N-(2-hydrazinylethyl)-3-methylcyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | N-(2-hydrazinylethyl)-3-methylcyclohexa-1,5-dien-1-amine |
| PubChem CID | 89045039 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | N-(2-hydrazinylethyl)-3-methylcyclohexa-1,5-dien-1-amine |
| SMILES | CC1C=C(NCCNN)C=CC1 |
| InChI | InChI=1S/C9H17N3/c1-8-3-2-4-9(7-8)11-5-6-12-10/h2,4,7-8,11-12H,3,5-6,10H2,1H3 |
| InChIKey | QBHCXWJEWPNBFA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-hydrazinylethyl)-3-methylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydrazinylethyl)-3-methylcyclohexa-1,5-dien-1-amine?
The IUPAC name of N-(2-hydrazinylethyl)-3-methylcyclohexa-1,5-dien-1-amine (CID 89045039) is N-(2-hydrazinylethyl)-3-methylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for N-(2-hydrazinylethyl)-3-methylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for N-(2-hydrazinylethyl)-3-methylcyclohexa-1,5-dien-1-amine is CC1C=C(NCCNN)C=CC1.
What is the InChIKey of N-(2-hydrazinylethyl)-3-methylcyclohexa-1,5-dien-1-amine?
The InChIKey is QBHCXWJEWPNBFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3/c1-8-3-2-4-9(7-8)11-5-6-12-10/h2,4,7-8,11-12H,3,5-6,10H2,1H3.
What are the key properties of N-(2-hydrazinylethyl)-3-methylcyclohexa-1,5-dien-1-amine?
N-(2-hydrazinylethyl)-3-methylcyclohexa-1,5-dien-1-amine has a molecular weight of 167.26 g/mol, XLogP of 0.52, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydrazinylethyl)-3-methylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 89045039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).